About 6-(2-methoxyethoxy)-2,3-dimethyl-2,3-dihydropyridine
6-(2-methoxyethoxy)-2,3-dimethyl-2,3-dihydropyridine (PubChem CID 166648845) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 6-(2-methoxyethoxy)-2,3-dimethyl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 6-(2-methoxyethoxy)-2,3-dimethyl-2,3-dihydropyridine |
| PubChem CID | 166648845 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 6-(2-methoxyethoxy)-2,3-dimethyl-2,3-dihydropyridine |
| SMILES | COCCOC1=NC(C)C(C)C=C1 |
| InChI | InChI=1S/C10H17NO2/c1-8-4-5-10(11-9(8)2)13-7-6-12-3/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | RBTRVFGWNQOVLJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-methoxyethoxy)-2,3-dimethyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methoxyethoxy)-2,3-dimethyl-2,3-dihydropyridine?
The IUPAC name of 6-(2-methoxyethoxy)-2,3-dimethyl-2,3-dihydropyridine (CID 166648845) is 6-(2-methoxyethoxy)-2,3-dimethyl-2,3-dihydropyridine.
What is the SMILES notation for 6-(2-methoxyethoxy)-2,3-dimethyl-2,3-dihydropyridine?
The canonical SMILES for 6-(2-methoxyethoxy)-2,3-dimethyl-2,3-dihydropyridine is COCCOC1=NC(C)C(C)C=C1.
What is the InChIKey of 6-(2-methoxyethoxy)-2,3-dimethyl-2,3-dihydropyridine?
The InChIKey is RBTRVFGWNQOVLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-8-4-5-10(11-9(8)2)13-7-6-12-3/h4-5,8-9H,6-7H2,1-3H3.
What are the key properties of 6-(2-methoxyethoxy)-2,3-dimethyl-2,3-dihydropyridine?
6-(2-methoxyethoxy)-2,3-dimethyl-2,3-dihydropyridine has a molecular weight of 183.25 g/mol, XLogP of 1.64, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methoxyethoxy)-2,3-dimethyl-2,3-dihydropyridine is sourced from PubChem (CID 166648845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).