C17H12N2O4 — CID 166648979
1-(2,6-dioxopiperidin-3-yl)benzo[e][1,2]benzoxazole-7-carbaldehyde (PubChem CID 166648979) has the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. Its IUPAC name is 1-(2,6-dioxopiperidin-3-yl)benzo[e][1,2]benzoxazole-7-carbaldehyde.
| Compound Name | 1-(2,6-dioxopiperidin-3-yl)benzo[e][1,2]benzoxazole-7-carbaldehyde |
|---|---|
| PubChem CID | 166648979 |
| Molecular Formula | C17H12N2O4 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1-(2,6-dioxopiperidin-3-yl)benzo[e][1,2]benzoxazole-7-carbaldehyde |
| SMILES | O=Cc1ccc2c(ccc3onc(C4CCC(=O)NC4=O)c32)c1 |
| InChI | InChI=1S/C17H12N2O4/c20-8-9-1-3-11-10(7-9)2-5-13-15(11)16(19-23-13)12-4-6-14(21)18-17(12)22/h1-3,5,7-8,12H,4,6H2,(H,18,21,22) |
| InChIKey | RWALLRBRQYOAMR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|