About N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]cyclohexanamine
N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]cyclohexanamine (PubChem CID 166648981) has the molecular formula C16H27NO
and a molecular weight of 249.40 g/mol. Its IUPAC name is N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]cyclohexanamine.
Molecular Properties
| Compound Name | N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]cyclohexanamine |
| PubChem CID | 166648981 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]cyclohexanamine |
| SMILES | CC1C=CC(OCCNC2CCCCC2)=CC1C |
| InChI | InChI=1S/C16H27NO/c1-13-8-9-16(12-14(13)2)18-11-10-17-15-6-4-3-5-7-15/h8-9,12-15,17H,3-7,10-11H2,1-2H3 |
| InChIKey | TYMNHACLHRRKCL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]cyclohexanamine?
The IUPAC name of N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]cyclohexanamine (CID 166648981) is N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]cyclohexanamine.
What is the SMILES notation for N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]cyclohexanamine?
The canonical SMILES for N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]cyclohexanamine is CC1C=CC(OCCNC2CCCCC2)=CC1C.
What is the InChIKey of N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]cyclohexanamine?
The InChIKey is TYMNHACLHRRKCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO/c1-13-8-9-16(12-14(13)2)18-11-10-17-15-6-4-3-5-7-15/h8-9,12-15,17H,3-7,10-11H2,1-2H3.
What are the key properties of N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]cyclohexanamine?
N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]cyclohexanamine has a molecular weight of 249.40 g/mol, XLogP of 3.65, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]cyclohexanamine is sourced from PubChem (CID 166648981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).