About 1-[2-[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]pyrrolidin-2-one
1-[2-[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]pyrrolidin-2-one (PubChem CID 166649009) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-[2-[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[2-[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]pyrrolidin-2-one |
| PubChem CID | 166649009 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1-[2-[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]pyrrolidin-2-one |
| SMILES | CC1C=C(OCCN2CCCC2=O)C=C[C@@H]1C |
| InChI | InChI=1S/C14H21NO2/c1-11-5-6-13(10-12(11)2)17-9-8-15-7-3-4-14(15)16/h5-6,10-12H,3-4,7-9H2,1-2H3/t11-,12?/m0/s1 |
| InChIKey | HWCVMDBEZLXHLQ-PXYINDEMSA-N |
| XLogP | 2.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]pyrrolidin-2-one?
The IUPAC name of 1-[2-[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]pyrrolidin-2-one (CID 166649009) is 1-[2-[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]pyrrolidin-2-one.
What is the SMILES notation for 1-[2-[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]pyrrolidin-2-one?
The canonical SMILES for 1-[2-[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]pyrrolidin-2-one is CC1C=C(OCCN2CCCC2=O)C=C[C@@H]1C.
What is the InChIKey of 1-[2-[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]pyrrolidin-2-one?
The InChIKey is HWCVMDBEZLXHLQ-PXYINDEMSA-N. The full InChI is InChI=1S/C14H21NO2/c1-11-5-6-13(10-12(11)2)17-9-8-15-7-3-4-14(15)16/h5-6,10-12H,3-4,7-9H2,1-2H3/t11-,12?/m0/s1.
What are the key properties of 1-[2-[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]pyrrolidin-2-one?
1-[2-[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]pyrrolidin-2-one has a molecular weight of 235.33 g/mol, XLogP of 2.35, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxyethyl]pyrrolidin-2-one is sourced from PubChem (CID 166649009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).