About N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]pentan-3-amine
N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]pentan-3-amine (PubChem CID 166649077) has the molecular formula C15H27NO
and a molecular weight of 237.39 g/mol. Its IUPAC name is N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]pentan-3-amine.
Molecular Properties
| Compound Name | N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]pentan-3-amine |
| PubChem CID | 166649077 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]pentan-3-amine |
| SMILES | CCC(CC)NCCOC1=CC(C)C(C)C=C1 |
| InChI | InChI=1S/C15H27NO/c1-5-14(6-2)16-9-10-17-15-8-7-12(3)13(4)11-15/h7-8,11-14,16H,5-6,9-10H2,1-4H3 |
| InChIKey | NDDHBBAZSCFHGZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]pentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]pentan-3-amine?
The IUPAC name of N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]pentan-3-amine (CID 166649077) is N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]pentan-3-amine.
What is the SMILES notation for N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]pentan-3-amine?
The canonical SMILES for N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]pentan-3-amine is CCC(CC)NCCOC1=CC(C)C(C)C=C1.
What is the InChIKey of N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]pentan-3-amine?
The InChIKey is NDDHBBAZSCFHGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO/c1-5-14(6-2)16-9-10-17-15-8-7-12(3)13(4)11-15/h7-8,11-14,16H,5-6,9-10H2,1-4H3.
What are the key properties of N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]pentan-3-amine?
N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]pentan-3-amine has a molecular weight of 237.39 g/mol, XLogP of 3.51, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dimethylcyclohexa-1,5-dien-1-yl)oxyethyl]pentan-3-amine is sourced from PubChem (CID 166649077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).