C18H15N3O4 — CID 166649115
N-[1-[(3S)-2,6-dioxopiperidin-3-yl]benzo[e][1,2]benzoxazol-7-yl]acetamide (PubChem CID 166649115) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is N-[1-[(3S)-2,6-dioxopiperidin-3-yl]benzo[e][1,2]benzoxazol-7-yl]acetamide.
| Compound Name | N-[1-[(3S)-2,6-dioxopiperidin-3-yl]benzo[e][1,2]benzoxazol-7-yl]acetamide |
|---|---|
| PubChem CID | 166649115 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-[1-[(3S)-2,6-dioxopiperidin-3-yl]benzo[e][1,2]benzoxazol-7-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(ccc3onc([C@@H]4CCC(=O)NC4=O)c32)c1 |
| InChI | InChI=1S/C18H15N3O4/c1-9(22)19-11-3-4-12-10(8-11)2-6-14-16(12)17(21-25-14)13-5-7-15(23)20-18(13)24/h2-4,6,8,13H,5,7H2,1H3,(H,19,22)(H,20,23,24)/t13-/m0/s1 |
| InChIKey | YOOGIDQRPXEFRJ-ZDUSSCGKSA-N |
| XLogP | 2.46 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|