About 1-[(1R)-4,5-dimethyl-2-bicyclo[3.1.0]hexanyl]ethanamine
1-[(1R)-4,5-dimethyl-2-bicyclo[3.1.0]hexanyl]ethanamine (PubChem CID 166649489) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 1-[(1R)-4,5-dimethyl-2-bicyclo[3.1.0]hexanyl]ethanamine.
Molecular Properties
| Compound Name | 1-[(1R)-4,5-dimethyl-2-bicyclo[3.1.0]hexanyl]ethanamine |
| PubChem CID | 166649489 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 1-[(1R)-4,5-dimethyl-2-bicyclo[3.1.0]hexanyl]ethanamine |
| SMILES | CC(N)C1CC(C)C2(C)C[C@H]12 |
| InChI | InChI=1S/C10H19N/c1-6-4-8(7(2)11)9-5-10(6,9)3/h6-9H,4-5,11H2,1-3H3/t6?,7?,8?,9-,10?/m1/s1 |
| InChIKey | SNRJOZTYQGGKFF-ZIHHOPMFSA-N |
| XLogP | 2.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(1R)-4,5-dimethyl-2-bicyclo[3.1.0]hexanyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R)-4,5-dimethyl-2-bicyclo[3.1.0]hexanyl]ethanamine?
The IUPAC name of 1-[(1R)-4,5-dimethyl-2-bicyclo[3.1.0]hexanyl]ethanamine (CID 166649489) is 1-[(1R)-4,5-dimethyl-2-bicyclo[3.1.0]hexanyl]ethanamine.
What is the SMILES notation for 1-[(1R)-4,5-dimethyl-2-bicyclo[3.1.0]hexanyl]ethanamine?
The canonical SMILES for 1-[(1R)-4,5-dimethyl-2-bicyclo[3.1.0]hexanyl]ethanamine is CC(N)C1CC(C)C2(C)C[C@H]12.
What is the InChIKey of 1-[(1R)-4,5-dimethyl-2-bicyclo[3.1.0]hexanyl]ethanamine?
The InChIKey is SNRJOZTYQGGKFF-ZIHHOPMFSA-N. The full InChI is InChI=1S/C10H19N/c1-6-4-8(7(2)11)9-5-10(6,9)3/h6-9H,4-5,11H2,1-3H3/t6?,7?,8?,9-,10?/m1/s1.
What are the key properties of 1-[(1R)-4,5-dimethyl-2-bicyclo[3.1.0]hexanyl]ethanamine?
1-[(1R)-4,5-dimethyl-2-bicyclo[3.1.0]hexanyl]ethanamine has a molecular weight of 153.27 g/mol, XLogP of 2.02, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R)-4,5-dimethyl-2-bicyclo[3.1.0]hexanyl]ethanamine is sourced from PubChem (CID 166649489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).