C21H23N3 — CID 166649577
2-methyl-5-[2-[5-[2-(4-methylphenyl)ethyl]-2-pyridinyl]ethyl]pyrimidine (PubChem CID 166649577) has the molecular formula C21H23N3 and a molecular weight of 317.44 g/mol. Its IUPAC name is 2-methyl-5-[2-[5-[2-(4-methylphenyl)ethyl]-2-pyridinyl]ethyl]pyrimidine.
| Compound Name | 2-methyl-5-[2-[5-[2-(4-methylphenyl)ethyl]-2-pyridinyl]ethyl]pyrimidine |
|---|---|
| PubChem CID | 166649577 |
| Molecular Formula | C21H23N3 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 2-methyl-5-[2-[5-[2-(4-methylphenyl)ethyl]-2-pyridinyl]ethyl]pyrimidine |
| SMILES | Cc1ccc(CCc2ccc(CCc3cnc(C)nc3)nc2)cc1 |
| InChI | InChI=1S/C21H23N3/c1-16-3-5-18(6-4-16)7-8-19-9-11-21(24-13-19)12-10-20-14-22-17(2)23-15-20/h3-6,9,11,13-15H,7-8,10,12H2,1-2H3 |
| InChIKey | FGRKWTGRDXOPAR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |