C22H22F4O5S — CID 166649717
2-(4-cyclohexa-1,3-dien-1-yl-4-phenyl-3,5-dioxatricyclo[5.2.1.02,6]decan-8-yl)-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 166649717) has the molecular formula C22H22F4O5S and a molecular weight of 474.47 g/mol. Its IUPAC name is 2-(4-cyclohexa-1,3-dien-1-yl-4-phenyl-3,5-dioxatricyclo[5.2.1.02,6]decan-8-yl)-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-(4-cyclohexa-1,3-dien-1-yl-4-phenyl-3,5-dioxatricyclo[5.2.1.02,6]decan-8-yl)-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 166649717 |
| Molecular Formula | C22H22F4O5S |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 2-(4-cyclohexa-1,3-dien-1-yl-4-phenyl-3,5-dioxatricyclo[5.2.1.02,6]decan-8-yl)-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C1CC2CC1C1OC(C3=CC=CCC3)(c3ccccc3)OC21 |
| InChI | InChI=1S/C22H22F4O5S/c23-21(24,22(25,26)32(27,28)29)17-12-13-11-16(17)19-18(13)30-20(31-19,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-5,7-9,13,16-19H,6,10-12H2,(H,27,28,29) |
| InChIKey | HGXCJYBIOXPPFX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|