C25H26ClF2N5O4S — CID 166649753
[6-chloro-3-(2,2-dimethylpropanoylamino)-2-pyridinyl]methyl 2-(4-aminosulfanyl-2,5-difluorobenzoyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 166649753) has the molecular formula C25H26ClF2N5O4S and a molecular weight of 566.03 g/mol. Its IUPAC name is [6-chloro-3-(2,2-dimethylpropanoylamino)-2-pyridinyl]methyl 2-(4-aminosulfanyl-2,5-difluorobenzoyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | [6-chloro-3-(2,2-dimethylpropanoylamino)-2-pyridinyl]methyl 2-(4-aminosulfanyl-2,5-difluorobenzoyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 166649753 |
| Molecular Formula | C25H26ClF2N5O4S |
| Molecular Weight | 566.03 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | [6-chloro-3-(2,2-dimethylpropanoylamino)-2-pyridinyl]methyl 2-(4-aminosulfanyl-2,5-difluorobenzoyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)C(=O)Nc1ccc(Cl)nc1COC(=O)N1CC2=C(C1)CN(C(=O)c1cc(F)c(SN)cc1F)C2 |
| InChI | InChI=1S/C25H26ClF2N5O4S/c1-25(2,3)23(35)31-18-4-5-21(26)30-19(18)12-37-24(36)33-10-13-8-32(9-14(13)11-33)22(34)15-6-17(28)20(38-29)7-16(15)27/h4-7H,8-12,29H2,1-3H3,(H,31,35) |
| InChIKey | ACYWLDJBNOTTIM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.03 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|