C24H33FS — CID 166649859
1-tert-butyl-3-(1-fluoroethyl)-5-[(2E,4E)-5-(2-methylprop-2-enylsulfanyl)hepta-2,4,6-trien-2-yl]cyclohepta-1,3,5-triene (PubChem CID 166649859) has the molecular formula C24H33FS and a molecular weight of 372.59 g/mol. Its IUPAC name is 1-tert-butyl-3-(1-fluoroethyl)-5-[(2E,4E)-5-(2-methylprop-2-enylsulfanyl)hepta-2,4,6-trien-2-yl]cyclohepta-1,3,5-triene.
| Compound Name | 1-tert-butyl-3-(1-fluoroethyl)-5-[(2E,4E)-5-(2-methylprop-2-enylsulfanyl)hepta-2,4,6-trien-2-yl]cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 166649859 |
| Molecular Formula | C24H33FS |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 1-tert-butyl-3-(1-fluoroethyl)-5-[(2E,4E)-5-(2-methylprop-2-enylsulfanyl)hepta-2,4,6-trien-2-yl]cyclohepta-1,3,5-triene |
| SMILES | C=C/C(=C\C=C(/C)C1=CCC(C(C)(C)C)=CC(C(C)F)=C1)SCC(=C)C |
| InChI | InChI=1S/C24H33FS/c1-9-23(26-16-17(2)3)13-10-18(4)20-11-12-22(24(6,7)8)15-21(14-20)19(5)25/h9-11,13-15,19H,1-2,12,16H2,3-8H3/b18-10+,23-13+ |
| InChIKey | IOXNDHTVNDETAA-OFNXDONCSA-N |
| XLogP | 7.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|