C14H22N2 — CID 166649943
(1R,10Z)-8-ethyl-6-methylidene-2,4-diazabicyclo[10.1.0]trideca-3,10-diene (PubChem CID 166649943) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (1R,10Z)-8-ethyl-6-methylidene-2,4-diazabicyclo[10.1.0]trideca-3,10-diene.
| Compound Name | (1R,10Z)-8-ethyl-6-methylidene-2,4-diazabicyclo[10.1.0]trideca-3,10-diene |
|---|---|
| PubChem CID | 166649943 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (1R,10Z)-8-ethyl-6-methylidene-2,4-diazabicyclo[10.1.0]trideca-3,10-diene |
| SMILES | C=C1C/N=C/N[C@@H]2CC2/C=C\CC(CC)C1 |
| InChI | InChI=1S/C14H22N2/c1-3-12-5-4-6-13-8-14(13)16-10-15-9-11(2)7-12/h4,6,10,12-14H,2-3,5,7-9H2,1H3,(H,15,16)/b6-4-/t12?,13?,14-/m1/s1 |
| InChIKey | WNLKFNFEWZDUDR-ZWDWZPANSA-N |
| XLogP | 2.93 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|