C23H29ClF6N4O3 — CID 166650548
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-chloro-2-[2-(1-hydroxyethyl)-2,7-diazaspiro[3.4]octan-7-yl]phenyl]methyl]piperazine-1-carboxylate (PubChem CID 166650548) has the molecular formula C23H29ClF6N4O3 and a molecular weight of 558.95 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-chloro-2-[2-(1-hydroxyethyl)-2,7-diazaspiro[3.4]octan-7-yl]phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-chloro-2-[2-(1-hydroxyethyl)-2,7-diazaspiro[3.4]octan-7-yl]phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166650548 |
| Molecular Formula | C23H29ClF6N4O3 |
| Molecular Weight | 558.95 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-chloro-2-[2-(1-hydroxyethyl)-2,7-diazaspiro[3.4]octan-7-yl]phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(O)N1CC2(CCN(c3cc(Cl)ccc3CN3CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC3)C2)C1 |
| InChI | InChI=1S/C23H29ClF6N4O3/c1-15(35)34-13-21(14-34)4-5-33(12-21)18-10-17(24)3-2-16(18)11-31-6-8-32(9-7-31)20(36)37-19(22(25,26)27)23(28,29)30/h2-3,10,15,19,35H,4-9,11-14H2,1H3 |
| InChIKey | URFKBZVVQPPRJD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.95 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |