C19H30N2 — CID 166650825
(9E)-N,4,11,11-tetramethyl-9-[(3E)-penta-1,3-dien-3-yl]-1-azacycloundeca-7,9-dien-2-imine (PubChem CID 166650825) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is (9E)-N,4,11,11-tetramethyl-9-[(3E)-penta-1,3-dien-3-yl]-1-azacycloundeca-7,9-dien-2-imine.
| Compound Name | (9E)-N,4,11,11-tetramethyl-9-[(3E)-penta-1,3-dien-3-yl]-1-azacycloundeca-7,9-dien-2-imine |
|---|---|
| PubChem CID | 166650825 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | (9E)-N,4,11,11-tetramethyl-9-[(3E)-penta-1,3-dien-3-yl]-1-azacycloundeca-7,9-dien-2-imine |
| SMILES | C=CC(=C\C)/C1=C/C(C)(C)N/C(=N/C)CC(C)CCC=C1 |
| InChI | InChI=1S/C19H30N2/c1-7-16(8-2)17-12-10-9-11-15(3)13-18(20-6)21-19(4,5)14-17/h7-8,10,12,14-15H,1,9,11,13H2,2-6H3,(H,20,21)/b12-10?,16-8+,17-14+ |
| InChIKey | VXJKWSIYALJAMV-CUDNHRBJSA-N |
| XLogP | 4.82 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|