C11H17N — CID 166650843
N-[(4Z)-2,5-dimethylhepta-2,4,6-trien-3-yl]ethanimine (PubChem CID 166650843) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is N-[(4Z)-2,5-dimethylhepta-2,4,6-trien-3-yl]ethanimine.
| Compound Name | N-[(4Z)-2,5-dimethylhepta-2,4,6-trien-3-yl]ethanimine |
|---|---|
| PubChem CID | 166650843 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | N-[(4Z)-2,5-dimethylhepta-2,4,6-trien-3-yl]ethanimine |
| SMILES | C=C/C(C)=C\C(/N=C/C)=C(C)C |
| InChI | InChI=1S/C11H17N/c1-6-10(5)8-11(9(3)4)12-7-2/h6-8H,1H2,2-5H3/b10-8-,12-7+ |
| InChIKey | FKDPWLBWHLFATF-GJIIZVESSA-N |
| XLogP | 3.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|