C27H28F2N6O2S — CID 166650974
3-[[4-[[2-(1,1-difluoroethyl)-1,3-thiazol-4-yl]methoxy]-3-methoxyphenyl]methyl]-6-[(2Z,4E)-1-methyliminohexa-2,4-dien-2-yl]imidazo[4,5-b]pyridin-2-amine (PubChem CID 166650974) has the molecular formula C27H28F2N6O2S and a molecular weight of 538.62 g/mol. Its IUPAC name is 3-[[4-[[2-(1,1-difluoroethyl)-1,3-thiazol-4-yl]methoxy]-3-methoxyphenyl]methyl]-6-[(2Z,4E)-1-methyliminohexa-2,4-dien-2-yl]imidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-[[4-[[2-(1,1-difluoroethyl)-1,3-thiazol-4-yl]methoxy]-3-methoxyphenyl]methyl]-6-[(2Z,4E)-1-methyliminohexa-2,4-dien-2-yl]imidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 166650974 |
| Molecular Formula | C27H28F2N6O2S |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 3-[[4-[[2-(1,1-difluoroethyl)-1,3-thiazol-4-yl]methoxy]-3-methoxyphenyl]methyl]-6-[(2Z,4E)-1-methyliminohexa-2,4-dien-2-yl]imidazo[4,5-b]pyridin-2-amine |
| SMILES | C/C=C/C=C(\C=N\C)c1cnc2c(c1)nc(N)n2Cc1ccc(OCc2csc(C(C)(F)F)n2)c(OC)c1 |
| InChI | InChI=1S/C27H28F2N6O2S/c1-5-6-7-18(12-31-3)19-11-21-24(32-13-19)35(26(30)34-21)14-17-8-9-22(23(10-17)36-4)37-15-20-16-38-25(33-20)27(2,28)29/h5-13,16H,14-15H2,1-4H3,(H2,30,34)/b6-5+,18-7+,31-12+ |
| InChIKey | ZVQKJHSKNAJLQC-XUVRUIKASA-N |
| XLogP | 5.88 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|