C15H23F2N — CID 166651332
(3Z,5E)-7,7-difluoro-3-[(3E)-hexa-1,3-dien-3-yl]-6-methylocta-3,5-dien-2-amine (PubChem CID 166651332) has the molecular formula C15H23F2N and a molecular weight of 255.35 g/mol. Its IUPAC name is (3Z,5E)-7,7-difluoro-3-[(3E)-hexa-1,3-dien-3-yl]-6-methylocta-3,5-dien-2-amine.
| Compound Name | (3Z,5E)-7,7-difluoro-3-[(3E)-hexa-1,3-dien-3-yl]-6-methylocta-3,5-dien-2-amine |
|---|---|
| PubChem CID | 166651332 |
| Molecular Formula | C15H23F2N |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (3Z,5E)-7,7-difluoro-3-[(3E)-hexa-1,3-dien-3-yl]-6-methylocta-3,5-dien-2-amine |
| SMILES | C=CC(=C\CC)/C(=C/C=C(\C)C(C)(F)F)C(C)N |
| InChI | InChI=1S/C15H23F2N/c1-6-8-13(7-2)14(12(4)18)10-9-11(3)15(5,16)17/h7-10,12H,2,6,18H2,1,3-5H3/b11-9+,13-8+,14-10+ |
| InChIKey | XXGSXKXYXHZVIX-BWHMKOIUSA-N |
| XLogP | 4.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|