C13H20F2N2 — CID 166651400
1-[(Z)-3,4-difluoro-2-methylidenepent-3-enyl]-2,2-dimethyl-1-penta-1,4-dien-2-ylhydrazine (PubChem CID 166651400) has the molecular formula C13H20F2N2 and a molecular weight of 242.31 g/mol. Its IUPAC name is 1-[(Z)-3,4-difluoro-2-methylidenepent-3-enyl]-2,2-dimethyl-1-penta-1,4-dien-2-ylhydrazine.
| Compound Name | 1-[(Z)-3,4-difluoro-2-methylidenepent-3-enyl]-2,2-dimethyl-1-penta-1,4-dien-2-ylhydrazine |
|---|---|
| PubChem CID | 166651400 |
| Molecular Formula | C13H20F2N2 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 1-[(Z)-3,4-difluoro-2-methylidenepent-3-enyl]-2,2-dimethyl-1-penta-1,4-dien-2-ylhydrazine |
| SMILES | C=CCC(=C)N(CC(=C)/C(F)=C(\C)F)N(C)C |
| InChI | InChI=1S/C13H20F2N2/c1-7-8-11(3)17(16(5)6)9-10(2)13(15)12(4)14/h7H,1-3,8-9H2,4-6H3/b13-12- |
| InChIKey | BAHLZRBGYFIJSE-SEYXRHQNSA-N |
| XLogP | 3.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|