C21H33F2N — CID 166651414
(6E,7E)-N-ethenyl-3-ethyl-2-fluoro-8-(2-fluoropropan-2-yl)-2-methyl-6-propylidenedeca-7,9-dien-5-imine (PubChem CID 166651414) has the molecular formula C21H33F2N and a molecular weight of 337.50 g/mol. Its IUPAC name is (6E,7E)-N-ethenyl-3-ethyl-2-fluoro-8-(2-fluoropropan-2-yl)-2-methyl-6-propylidenedeca-7,9-dien-5-imine.
| Compound Name | (6E,7E)-N-ethenyl-3-ethyl-2-fluoro-8-(2-fluoropropan-2-yl)-2-methyl-6-propylidenedeca-7,9-dien-5-imine |
|---|---|
| PubChem CID | 166651414 |
| Molecular Formula | C21H33F2N |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | (6E,7E)-N-ethenyl-3-ethyl-2-fluoro-8-(2-fluoropropan-2-yl)-2-methyl-6-propylidenedeca-7,9-dien-5-imine |
| SMILES | C=C/N=C(CC(CC)C(C)(C)F)/C(=C/CC)/C=C(\C=C)C(C)(C)F |
| InChI | InChI=1S/C21H33F2N/c1-9-13-16(14-17(10-2)20(5,6)22)19(24-12-4)15-18(11-3)21(7,8)23/h10,12-14,18H,2,4,9,11,15H2,1,3,5-8H3/b16-13+,17-14+,24-19+ |
| InChIKey | XMRBPMMAICGJQT-SPIGWISPSA-N |
| XLogP | 6.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|