About (3-ethyl-2-methyl-7-propylcyclohepta-1,3,6-trien-1-yl)phosphane
(3-ethyl-2-methyl-7-propylcyclohepta-1,3,6-trien-1-yl)phosphane (PubChem CID 166651426) has the molecular formula C13H21P
and a molecular weight of 208.28 g/mol. Its IUPAC name is (3-ethyl-2-methyl-7-propylcyclohepta-1,3,6-trien-1-yl)phosphane.
Molecular Properties
| Compound Name | (3-ethyl-2-methyl-7-propylcyclohepta-1,3,6-trien-1-yl)phosphane |
| PubChem CID | 166651426 |
| Molecular Formula | C13H21P |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | (3-ethyl-2-methyl-7-propylcyclohepta-1,3,6-trien-1-yl)phosphane |
| SMILES | CCCC1=CCC=C(CC)C(C)=C1P |
| InChI | InChI=1S/C13H21P/c1-4-7-12-9-6-8-11(5-2)10(3)13(12)14/h8-9H,4-7,14H2,1-3H3 |
| InChIKey | ZRQFOTWTWDXDBA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-ethyl-2-methyl-7-propylcyclohepta-1,3,6-trien-1-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-2-methyl-7-propylcyclohepta-1,3,6-trien-1-yl)phosphane?
The IUPAC name of (3-ethyl-2-methyl-7-propylcyclohepta-1,3,6-trien-1-yl)phosphane (CID 166651426) is (3-ethyl-2-methyl-7-propylcyclohepta-1,3,6-trien-1-yl)phosphane.
What is the SMILES notation for (3-ethyl-2-methyl-7-propylcyclohepta-1,3,6-trien-1-yl)phosphane?
The canonical SMILES for (3-ethyl-2-methyl-7-propylcyclohepta-1,3,6-trien-1-yl)phosphane is CCCC1=CCC=C(CC)C(C)=C1P.
What is the InChIKey of (3-ethyl-2-methyl-7-propylcyclohepta-1,3,6-trien-1-yl)phosphane?
The InChIKey is ZRQFOTWTWDXDBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21P/c1-4-7-12-9-6-8-11(5-2)10(3)13(12)14/h8-9H,4-7,14H2,1-3H3.
What are the key properties of (3-ethyl-2-methyl-7-propylcyclohepta-1,3,6-trien-1-yl)phosphane?
(3-ethyl-2-methyl-7-propylcyclohepta-1,3,6-trien-1-yl)phosphane has a molecular weight of 208.28 g/mol, XLogP of 4.60, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-2-methyl-7-propylcyclohepta-1,3,6-trien-1-yl)phosphane is sourced from PubChem (CID 166651426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).