About 1-[[(5R)-6-fluoro-5-methylcyclohexa-1,3-dien-1-yl]methyl]-1,2-dimethylhydrazine
1-[[(5R)-6-fluoro-5-methylcyclohexa-1,3-dien-1-yl]methyl]-1,2-dimethylhydrazine (PubChem CID 166651439) has the molecular formula C10H17FN2
and a molecular weight of 184.26 g/mol. Its IUPAC name is 1-[[(5R)-6-fluoro-5-methylcyclohexa-1,3-dien-1-yl]methyl]-1,2-dimethylhydrazine.
Molecular Properties
| Compound Name | 1-[[(5R)-6-fluoro-5-methylcyclohexa-1,3-dien-1-yl]methyl]-1,2-dimethylhydrazine |
| PubChem CID | 166651439 |
| Molecular Formula | C10H17FN2 |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | 1-[[(5R)-6-fluoro-5-methylcyclohexa-1,3-dien-1-yl]methyl]-1,2-dimethylhydrazine |
| SMILES | CNN(C)CC1=CC=C[C@@H](C)C1F |
| InChI | InChI=1S/C10H17FN2/c1-8-5-4-6-9(10(8)11)7-13(3)12-2/h4-6,8,10,12H,7H2,1-3H3/t8-,10?/m1/s1 |
| InChIKey | DQSWTUVJFPLXKT-HNHGDDPOSA-N |
| XLogP | 1.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(5R)-6-fluoro-5-methylcyclohexa-1,3-dien-1-yl]methyl]-1,2-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(5R)-6-fluoro-5-methylcyclohexa-1,3-dien-1-yl]methyl]-1,2-dimethylhydrazine?
The IUPAC name of 1-[[(5R)-6-fluoro-5-methylcyclohexa-1,3-dien-1-yl]methyl]-1,2-dimethylhydrazine (CID 166651439) is 1-[[(5R)-6-fluoro-5-methylcyclohexa-1,3-dien-1-yl]methyl]-1,2-dimethylhydrazine.
What is the SMILES notation for 1-[[(5R)-6-fluoro-5-methylcyclohexa-1,3-dien-1-yl]methyl]-1,2-dimethylhydrazine?
The canonical SMILES for 1-[[(5R)-6-fluoro-5-methylcyclohexa-1,3-dien-1-yl]methyl]-1,2-dimethylhydrazine is CNN(C)CC1=CC=C[C@@H](C)C1F.
What is the InChIKey of 1-[[(5R)-6-fluoro-5-methylcyclohexa-1,3-dien-1-yl]methyl]-1,2-dimethylhydrazine?
The InChIKey is DQSWTUVJFPLXKT-HNHGDDPOSA-N. The full InChI is InChI=1S/C10H17FN2/c1-8-5-4-6-9(10(8)11)7-13(3)12-2/h4-6,8,10,12H,7H2,1-3H3/t8-,10?/m1/s1.
What are the key properties of 1-[[(5R)-6-fluoro-5-methylcyclohexa-1,3-dien-1-yl]methyl]-1,2-dimethylhydrazine?
1-[[(5R)-6-fluoro-5-methylcyclohexa-1,3-dien-1-yl]methyl]-1,2-dimethylhydrazine has a molecular weight of 184.26 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(5R)-6-fluoro-5-methylcyclohexa-1,3-dien-1-yl]methyl]-1,2-dimethylhydrazine is sourced from PubChem (CID 166651439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).