C14H17F2N — CID 166651452
(2Z,4Z,6E)-8-fluoro-2-[2-(fluoromethyl)prop-2-enylidene]-7-methyl-3-methylideneocta-4,6-dien-1-imine (PubChem CID 166651452) has the molecular formula C14H17F2N and a molecular weight of 237.29 g/mol. Its IUPAC name is (2Z,4Z,6E)-8-fluoro-2-[2-(fluoromethyl)prop-2-enylidene]-7-methyl-3-methylideneocta-4,6-dien-1-imine.
| Compound Name | (2Z,4Z,6E)-8-fluoro-2-[2-(fluoromethyl)prop-2-enylidene]-7-methyl-3-methylideneocta-4,6-dien-1-imine |
|---|---|
| PubChem CID | 166651452 |
| Molecular Formula | C14H17F2N |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | (2Z,4Z,6E)-8-fluoro-2-[2-(fluoromethyl)prop-2-enylidene]-7-methyl-3-methylideneocta-4,6-dien-1-imine |
| SMILES | [H]/N=C/C(=C\C(=C)CF)C(=C)/C=C\C=C(/C)CF |
| InChI | InChI=1S/C14H17F2N/c1-11(8-15)5-4-6-13(3)14(10-17)7-12(2)9-16/h4-7,10,17H,2-3,8-9H2,1H3/b6-4-,11-5+,14-7+,17-10+ |
| InChIKey | ODCDGFXEHLUXBW-VCNXOBTASA-N |
| XLogP | 4.12 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|