About 6-[(E)-but-2-en-2-yl]-4,5-dihydropyrimidine-4-carbonitrile
6-[(E)-but-2-en-2-yl]-4,5-dihydropyrimidine-4-carbonitrile (PubChem CID 166651473) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 6-[(E)-but-2-en-2-yl]-4,5-dihydropyrimidine-4-carbonitrile.
Molecular Properties
| Compound Name | 6-[(E)-but-2-en-2-yl]-4,5-dihydropyrimidine-4-carbonitrile |
| PubChem CID | 166651473 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 6-[(E)-but-2-en-2-yl]-4,5-dihydropyrimidine-4-carbonitrile |
| SMILES | C/C=C(\C)C1=NC=NC(C#N)C1 |
| InChI | InChI=1S/C9H11N3/c1-3-7(2)9-4-8(5-10)11-6-12-9/h3,6,8H,4H2,1-2H3/b7-3+ |
| InChIKey | YNYLBVGGZDMQHH-XVNBXDOJSA-N |
| XLogP | 1.72 |
| TPSA | 48.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(E)-but-2-en-2-yl]-4,5-dihydropyrimidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(E)-but-2-en-2-yl]-4,5-dihydropyrimidine-4-carbonitrile?
The IUPAC name of 6-[(E)-but-2-en-2-yl]-4,5-dihydropyrimidine-4-carbonitrile (CID 166651473) is 6-[(E)-but-2-en-2-yl]-4,5-dihydropyrimidine-4-carbonitrile.
What is the SMILES notation for 6-[(E)-but-2-en-2-yl]-4,5-dihydropyrimidine-4-carbonitrile?
The canonical SMILES for 6-[(E)-but-2-en-2-yl]-4,5-dihydropyrimidine-4-carbonitrile is C/C=C(\C)C1=NC=NC(C#N)C1.
What is the InChIKey of 6-[(E)-but-2-en-2-yl]-4,5-dihydropyrimidine-4-carbonitrile?
The InChIKey is YNYLBVGGZDMQHH-XVNBXDOJSA-N. The full InChI is InChI=1S/C9H11N3/c1-3-7(2)9-4-8(5-10)11-6-12-9/h3,6,8H,4H2,1-2H3/b7-3+.
What are the key properties of 6-[(E)-but-2-en-2-yl]-4,5-dihydropyrimidine-4-carbonitrile?
6-[(E)-but-2-en-2-yl]-4,5-dihydropyrimidine-4-carbonitrile has a molecular weight of 161.21 g/mol, XLogP of 1.72, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(E)-but-2-en-2-yl]-4,5-dihydropyrimidine-4-carbonitrile is sourced from PubChem (CID 166651473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).