About (2Z)-2-ethylidene-3,4-difluorohexan-1-amine
(2Z)-2-ethylidene-3,4-difluorohexan-1-amine (PubChem CID 166651478) has the molecular formula C8H15F2N
and a molecular weight of 163.21 g/mol. Its IUPAC name is (2Z)-2-ethylidene-3,4-difluorohexan-1-amine.
Molecular Properties
| Compound Name | (2Z)-2-ethylidene-3,4-difluorohexan-1-amine |
| PubChem CID | 166651478 |
| Molecular Formula | C8H15F2N |
| Molecular Weight | 163.21 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | (2Z)-2-ethylidene-3,4-difluorohexan-1-amine |
| SMILES | C/C=C(/CN)C(F)C(F)CC |
| InChI | InChI=1S/C8H15F2N/c1-3-6(5-11)8(10)7(9)4-2/h3,7-8H,4-5,11H2,1-2H3/b6-3- |
| InChIKey | OGTMCKGDDOXMOL-UTCJRWHESA-N |
| XLogP | 1.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-ethylidene-3,4-difluorohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-ethylidene-3,4-difluorohexan-1-amine?
The IUPAC name of (2Z)-2-ethylidene-3,4-difluorohexan-1-amine (CID 166651478) is (2Z)-2-ethylidene-3,4-difluorohexan-1-amine.
What is the SMILES notation for (2Z)-2-ethylidene-3,4-difluorohexan-1-amine?
The canonical SMILES for (2Z)-2-ethylidene-3,4-difluorohexan-1-amine is C/C=C(/CN)C(F)C(F)CC.
What is the InChIKey of (2Z)-2-ethylidene-3,4-difluorohexan-1-amine?
The InChIKey is OGTMCKGDDOXMOL-UTCJRWHESA-N. The full InChI is InChI=1S/C8H15F2N/c1-3-6(5-11)8(10)7(9)4-2/h3,7-8H,4-5,11H2,1-2H3/b6-3-.
What are the key properties of (2Z)-2-ethylidene-3,4-difluorohexan-1-amine?
(2Z)-2-ethylidene-3,4-difluorohexan-1-amine has a molecular weight of 163.21 g/mol, XLogP of 1.98, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-ethylidene-3,4-difluorohexan-1-amine is sourced from PubChem (CID 166651478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).