C19H23F3N2O4 — CID 166651494
[(E)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate (PubChem CID 166651494) has the molecular formula C19H23F3N2O4 and a molecular weight of 400.40 g/mol. Its IUPAC name is [(E)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate.
| Compound Name | [(E)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 166651494 |
| Molecular Formula | C19H23F3N2O4 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [(E)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate |
| SMILES | COCCCC/C(=N\OC(=O)C1(C)CC(C)=NO1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H23F3N2O4/c1-13-12-18(2,28-23-13)17(25)27-24-16(6-4-5-11-26-3)14-7-9-15(10-8-14)19(20,21)22/h7-10H,4-6,11-12H2,1-3H3/b24-16+ |
| InChIKey | GCXXIXKFMVHTFY-LFVJCYFKSA-N |
| XLogP | 4.32 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|