C32H54FN — CID 166651505
1-[(4Z,6Z)-9-tert-butyl-7-(1-fluoroethyl)-10,12-dimethyl-4-propan-2-yl-11-prop-1-en-2-yltrideca-4,6,10,12-tetraenyl]piperidine (PubChem CID 166651505) has the molecular formula C32H54FN and a molecular weight of 471.79 g/mol. Its IUPAC name is 1-[(4Z,6Z)-9-tert-butyl-7-(1-fluoroethyl)-10,12-dimethyl-4-propan-2-yl-11-prop-1-en-2-yltrideca-4,6,10,12-tetraenyl]piperidine.
| Compound Name | 1-[(4Z,6Z)-9-tert-butyl-7-(1-fluoroethyl)-10,12-dimethyl-4-propan-2-yl-11-prop-1-en-2-yltrideca-4,6,10,12-tetraenyl]piperidine |
|---|---|
| PubChem CID | 166651505 |
| Molecular Formula | C32H54FN |
| Molecular Weight | 471.79 g/mol |
| Exact Mass | 471.42 |
| IUPAC Name | 1-[(4Z,6Z)-9-tert-butyl-7-(1-fluoroethyl)-10,12-dimethyl-4-propan-2-yl-11-prop-1-en-2-yltrideca-4,6,10,12-tetraenyl]piperidine |
| SMILES | C=C(C)C(C(=C)C)=C(C)C(C/C(=C/C=C(/CCCN1CCCCC1)C(C)C)C(C)F)C(C)(C)C |
| InChI | InChI=1S/C32H54FN/c1-23(2)28(16-15-21-34-19-13-12-14-20-34)17-18-29(27(8)33)22-30(32(9,10)11)26(7)31(24(3)4)25(5)6/h17-18,23,27,30H,3,5,12-16,19-22H2,1-2,4,6-11H3/b28-17-,29-18- |
| InChIKey | WKYRIEBILNYICJ-SZVCAHDZSA-N |
| XLogP | 9.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.79 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|