About (2Z,4E)-N-ethenyl-4-(2-fluoropropan-2-yl)-N-methylhexa-2,4-dien-1-amine
(2Z,4E)-N-ethenyl-4-(2-fluoropropan-2-yl)-N-methylhexa-2,4-dien-1-amine (PubChem CID 166651513) has the molecular formula C12H20FN
and a molecular weight of 197.30 g/mol. Its IUPAC name is (2Z,4E)-N-ethenyl-4-(2-fluoropropan-2-yl)-N-methylhexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (2Z,4E)-N-ethenyl-4-(2-fluoropropan-2-yl)-N-methylhexa-2,4-dien-1-amine |
| PubChem CID | 166651513 |
| Molecular Formula | C12H20FN |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | (2Z,4E)-N-ethenyl-4-(2-fluoropropan-2-yl)-N-methylhexa-2,4-dien-1-amine |
| SMILES | C=CN(C)C/C=C\C(=C/C)C(C)(C)F |
| InChI | InChI=1S/C12H20FN/c1-6-11(12(3,4)13)9-8-10-14(5)7-2/h6-9H,2,10H2,1,3-5H3/b9-8-,11-6+ |
| InChIKey | KTKQABSHOZMMQJ-XSONURMYSA-N |
| XLogP | 3.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-N-ethenyl-4-(2-fluoropropan-2-yl)-N-methylhexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-N-ethenyl-4-(2-fluoropropan-2-yl)-N-methylhexa-2,4-dien-1-amine?
The IUPAC name of (2Z,4E)-N-ethenyl-4-(2-fluoropropan-2-yl)-N-methylhexa-2,4-dien-1-amine (CID 166651513) is (2Z,4E)-N-ethenyl-4-(2-fluoropropan-2-yl)-N-methylhexa-2,4-dien-1-amine.
What is the SMILES notation for (2Z,4E)-N-ethenyl-4-(2-fluoropropan-2-yl)-N-methylhexa-2,4-dien-1-amine?
The canonical SMILES for (2Z,4E)-N-ethenyl-4-(2-fluoropropan-2-yl)-N-methylhexa-2,4-dien-1-amine is C=CN(C)C/C=C\C(=C/C)C(C)(C)F.
What is the InChIKey of (2Z,4E)-N-ethenyl-4-(2-fluoropropan-2-yl)-N-methylhexa-2,4-dien-1-amine?
The InChIKey is KTKQABSHOZMMQJ-XSONURMYSA-N. The full InChI is InChI=1S/C12H20FN/c1-6-11(12(3,4)13)9-8-10-14(5)7-2/h6-9H,2,10H2,1,3-5H3/b9-8-,11-6+.
What are the key properties of (2Z,4E)-N-ethenyl-4-(2-fluoropropan-2-yl)-N-methylhexa-2,4-dien-1-amine?
(2Z,4E)-N-ethenyl-4-(2-fluoropropan-2-yl)-N-methylhexa-2,4-dien-1-amine has a molecular weight of 197.30 g/mol, XLogP of 3.31, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-N-ethenyl-4-(2-fluoropropan-2-yl)-N-methylhexa-2,4-dien-1-amine is sourced from PubChem (CID 166651513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).