C14H16F3N — CID 166651529
6-(4-methylpenta-1,3-dien-2-yl)-2-(trifluoromethyl)-3,6-dihydroazocine (PubChem CID 166651529) has the molecular formula C14H16F3N and a molecular weight of 255.28 g/mol. Its IUPAC name is 6-(4-methylpenta-1,3-dien-2-yl)-2-(trifluoromethyl)-3,6-dihydroazocine.
| Compound Name | 6-(4-methylpenta-1,3-dien-2-yl)-2-(trifluoromethyl)-3,6-dihydroazocine |
|---|---|
| PubChem CID | 166651529 |
| Molecular Formula | C14H16F3N |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 6-(4-methylpenta-1,3-dien-2-yl)-2-(trifluoromethyl)-3,6-dihydroazocine |
| SMILES | C=C(C=C(C)C)C1C=CC/C(C(F)(F)F)=N\C=C1 |
| InChI | InChI=1S/C14H16F3N/c1-10(2)9-11(3)12-5-4-6-13(14(15,16)17)18-8-7-12/h4-5,7-9,12H,3,6H2,1-2H3/b5-4?,8-7?,18-13+ |
| InChIKey | ZRDAIRCJRQHZMQ-KKBWNPKMSA-N |
| XLogP | 4.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|