C27H35F2NS — CID 166651546
1-[(1E)-2-[1-[[4-(1-fluoroethyl)-6-[(2Z,4E)-5-fluorohepta-2,4,6-trien-3-yl]cyclohexa-2,4-dien-1-yl]amino]ethenyl]-3-methylbuta-1,3-dienyl]cyclopentane-1-thiol (PubChem CID 166651546) has the molecular formula C27H35F2NS and a molecular weight of 443.65 g/mol. Its IUPAC name is 1-[(1E)-2-[1-[[4-(1-fluoroethyl)-6-[(2Z,4E)-5-fluorohepta-2,4,6-trien-3-yl]cyclohexa-2,4-dien-1-yl]amino]ethenyl]-3-methylbuta-1,3-dienyl]cyclopentane-1-thiol.
| Compound Name | 1-[(1E)-2-[1-[[4-(1-fluoroethyl)-6-[(2Z,4E)-5-fluorohepta-2,4,6-trien-3-yl]cyclohexa-2,4-dien-1-yl]amino]ethenyl]-3-methylbuta-1,3-dienyl]cyclopentane-1-thiol |
|---|---|
| PubChem CID | 166651546 |
| Molecular Formula | C27H35F2NS |
| Molecular Weight | 443.65 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 1-[(1E)-2-[1-[[4-(1-fluoroethyl)-6-[(2Z,4E)-5-fluorohepta-2,4,6-trien-3-yl]cyclohexa-2,4-dien-1-yl]amino]ethenyl]-3-methylbuta-1,3-dienyl]cyclopentane-1-thiol |
| SMILES | C=C/C(F)=C\C(=C/C)C1C=C(C(C)F)C=CC1NC(=C)/C(=C/C1(S)CCCC1)C(=C)C |
| InChI | InChI=1S/C27H35F2NS/c1-7-21(15-23(29)8-2)24-16-22(19(5)28)11-12-26(24)30-20(6)25(18(3)4)17-27(31)13-9-10-14-27/h7-8,11-12,15-17,19,24,26,30-31H,2-3,6,9-10,13-14H2,1,4-5H3/b21-7+,23-15+,25-17+ |
| InChIKey | ZTEUAHJHZKCXIL-YYRXLBMBSA-N |
| XLogP | 7.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.65 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|