C18H29F2N — CID 166651561
2-[(2Z,5Z)-5-[(Z)-1,2-difluoroethenyl]-3-methylnona-2,5-dien-2-yl]-1,2-dimethylpyrrolidine (PubChem CID 166651561) has the molecular formula C18H29F2N and a molecular weight of 297.43 g/mol. Its IUPAC name is 2-[(2Z,5Z)-5-[(Z)-1,2-difluoroethenyl]-3-methylnona-2,5-dien-2-yl]-1,2-dimethylpyrrolidine.
| Compound Name | 2-[(2Z,5Z)-5-[(Z)-1,2-difluoroethenyl]-3-methylnona-2,5-dien-2-yl]-1,2-dimethylpyrrolidine |
|---|---|
| PubChem CID | 166651561 |
| Molecular Formula | C18H29F2N |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | 2-[(2Z,5Z)-5-[(Z)-1,2-difluoroethenyl]-3-methylnona-2,5-dien-2-yl]-1,2-dimethylpyrrolidine |
| SMILES | CCC/C=C(C/C(C)=C(/C)C1(C)CCCN1C)\C(F)=C\F |
| InChI | InChI=1S/C18H29F2N/c1-6-7-9-16(17(20)13-19)12-14(2)15(3)18(4)10-8-11-21(18)5/h9,13H,6-8,10-12H2,1-5H3/b15-14-,16-9-,17-13- |
| InChIKey | VXDUKHUGFWPXIE-UGLYYWHDSA-N |
| XLogP | 5.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|