C17H24F3N — CID 166651590
(2E,6E,8Z)-7-(1,1-difluoroethyl)-N-ethyl-1-fluoro-2,10-dimethylundeca-2,6,8,10-tetraen-4-imine (PubChem CID 166651590) has the molecular formula C17H24F3N and a molecular weight of 299.38 g/mol. Its IUPAC name is (2E,6E,8Z)-7-(1,1-difluoroethyl)-N-ethyl-1-fluoro-2,10-dimethylundeca-2,6,8,10-tetraen-4-imine.
| Compound Name | (2E,6E,8Z)-7-(1,1-difluoroethyl)-N-ethyl-1-fluoro-2,10-dimethylundeca-2,6,8,10-tetraen-4-imine |
|---|---|
| PubChem CID | 166651590 |
| Molecular Formula | C17H24F3N |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (2E,6E,8Z)-7-(1,1-difluoroethyl)-N-ethyl-1-fluoro-2,10-dimethylundeca-2,6,8,10-tetraen-4-imine |
| SMILES | C=C(C)/C=C\C(=C/CC(/C=C(\C)CF)=N/CC)C(C)(F)F |
| InChI | InChI=1S/C17H24F3N/c1-6-21-16(11-14(4)12-18)10-9-15(17(5,19)20)8-7-13(2)3/h7-9,11H,2,6,10,12H2,1,3-5H3/b8-7-,14-11+,15-9+,21-16- |
| InChIKey | HMCPPJOOUIZZOS-QJHLHFEUSA-N |
| XLogP | 5.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|