C18H30FN — CID 166651598
(3Z,6E,7Z,9Z)-N,8-diethyl-6-ethylidene-2-fluoro-5-methylundeca-3,7,9-trien-3-amine (PubChem CID 166651598) has the molecular formula C18H30FN and a molecular weight of 279.44 g/mol. Its IUPAC name is (3Z,6E,7Z,9Z)-N,8-diethyl-6-ethylidene-2-fluoro-5-methylundeca-3,7,9-trien-3-amine.
| Compound Name | (3Z,6E,7Z,9Z)-N,8-diethyl-6-ethylidene-2-fluoro-5-methylundeca-3,7,9-trien-3-amine |
|---|---|
| PubChem CID | 166651598 |
| Molecular Formula | C18H30FN |
| Molecular Weight | 279.44 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | (3Z,6E,7Z,9Z)-N,8-diethyl-6-ethylidene-2-fluoro-5-methylundeca-3,7,9-trien-3-amine |
| SMILES | C/C=C\C(=C/C(=C/C)C(C)/C=C(\NCC)C(C)F)CC |
| InChI | InChI=1S/C18H30FN/c1-7-11-16(8-2)13-17(9-3)14(5)12-18(15(6)19)20-10-4/h7,9,11-15,20H,8,10H2,1-6H3/b11-7-,16-13-,17-9-,18-12- |
| InChIKey | MLRNVGBMZDRPLS-VGCWUDDNSA-N |
| XLogP | 5.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|