C17H27F2N — CID 166651600
N-[(3Z,6E,7E)-6-ethylidene-2,2-difluoro-5,8,9-trimethyldeca-3,7-dien-3-yl]ethanimine (PubChem CID 166651600) has the molecular formula C17H27F2N and a molecular weight of 283.41 g/mol. Its IUPAC name is N-[(3Z,6E,7E)-6-ethylidene-2,2-difluoro-5,8,9-trimethyldeca-3,7-dien-3-yl]ethanimine.
| Compound Name | N-[(3Z,6E,7E)-6-ethylidene-2,2-difluoro-5,8,9-trimethyldeca-3,7-dien-3-yl]ethanimine |
|---|---|
| PubChem CID | 166651600 |
| Molecular Formula | C17H27F2N |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | N-[(3Z,6E,7E)-6-ethylidene-2,2-difluoro-5,8,9-trimethyldeca-3,7-dien-3-yl]ethanimine |
| SMILES | C/C=N/C(=C\C(C)C(/C=C(\C)C(C)C)=C\C)C(C)(F)F |
| InChI | InChI=1S/C17H27F2N/c1-8-15(10-13(5)12(3)4)14(6)11-16(20-9-2)17(7,18)19/h8-12,14H,1-7H3/b13-10+,15-8-,16-11-,20-9+ |
| InChIKey | YLELSLLHWZQNHD-WFMHMZBPSA-N |
| XLogP | 5.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|