About CID 16665162
CID 16665162 (PubChem CID 16665162) has the molecular formula C19H21N2O4
and a molecular weight of 341.39 g/mol.
Molecular Properties
| Compound Name | CID 16665162 |
| PubChem CID | 16665162 |
| Molecular Formula | C19H21N2O4 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | — |
| SMILES | CCOC(=O)CNC(=O)[C@H](C)NC(=O)c1cccc([C]2[CH][CH][CH][CH]2)c1 |
| InChI | InChI=1S/C19H21N2O4/c1-3-25-17(22)12-20-18(23)13(2)21-19(24)16-10-6-9-15(11-16)14-7-4-5-8-14/h4-11,13H,3,12H2,1-2H3,(H,20,23)(H,21,24)/t13-/m0/s1 |
| InChIKey | WXBMEBMVFGTOIC-ZDUSSCGKSA-N |
| XLogP | 1.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 16665162 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 16665162?
The IUPAC name of CID 16665162 (CID 16665162) is not available.
What is the SMILES notation for CID 16665162?
The canonical SMILES for CID 16665162 is CCOC(=O)CNC(=O)[C@H](C)NC(=O)c1cccc([C]2[CH][CH][CH][CH]2)c1.
What is the InChIKey of CID 16665162?
The InChIKey is WXBMEBMVFGTOIC-ZDUSSCGKSA-N. The full InChI is InChI=1S/C19H21N2O4/c1-3-25-17(22)12-20-18(23)13(2)21-19(24)16-10-6-9-15(11-16)14-7-4-5-8-14/h4-11,13H,3,12H2,1-2H3,(H,20,23)(H,21,24)/t13-/m0/s1.
What are the key properties of CID 16665162?
CID 16665162 has a molecular weight of 341.39 g/mol, XLogP of 1.24, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 16665162 is sourced from PubChem (CID 16665162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).