About [(E)-1-phenylethylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate
[(E)-1-phenylethylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate (PubChem CID 166651653) has the molecular formula C14H16N2O3
and a molecular weight of 260.29 g/mol. Its IUPAC name is [(E)-1-phenylethylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | [(E)-1-phenylethylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate |
| PubChem CID | 166651653 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | [(E)-1-phenylethylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate |
| SMILES | CC1=NOC(C)(C(=O)O/N=C(\C)c2ccccc2)C1 |
| InChI | InChI=1S/C14H16N2O3/c1-10-9-14(3,19-15-10)13(17)18-16-11(2)12-7-5-4-6-8-12/h4-8H,9H2,1-3H3/b16-11+ |
| InChIKey | GCFFSLVSXOZSDP-LFIBNONCSA-N |
| XLogP | 2.51 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-phenylethylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-phenylethylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate?
The IUPAC name of [(E)-1-phenylethylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate (CID 166651653) is [(E)-1-phenylethylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate.
What is the SMILES notation for [(E)-1-phenylethylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate?
The canonical SMILES for [(E)-1-phenylethylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate is CC1=NOC(C)(C(=O)O/N=C(\C)c2ccccc2)C1.
What is the InChIKey of [(E)-1-phenylethylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate?
The InChIKey is GCFFSLVSXOZSDP-LFIBNONCSA-N. The full InChI is InChI=1S/C14H16N2O3/c1-10-9-14(3,19-15-10)13(17)18-16-11(2)12-7-5-4-6-8-12/h4-8H,9H2,1-3H3/b16-11+.
What are the key properties of [(E)-1-phenylethylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate?
[(E)-1-phenylethylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate has a molecular weight of 260.29 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-phenylethylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 166651653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).