About 2-ethenyl-5-methylpyridine;4-ethenylpyridine
2-ethenyl-5-methylpyridine;4-ethenylpyridine (PubChem CID 166651862) has the molecular formula C15H16N2
and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-ethenyl-5-methylpyridine;4-ethenylpyridine.
Molecular Properties
| Compound Name | 2-ethenyl-5-methylpyridine;4-ethenylpyridine |
| PubChem CID | 166651862 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-ethenyl-5-methylpyridine;4-ethenylpyridine |
| SMILES | C=Cc1ccc(C)cn1.C=Cc1ccncc1 |
| InChI | InChI=1S/C8H9N.C7H7N/c1-3-8-5-4-7(2)6-9-8;1-2-7-3-5-8-6-4-7/h3-6H,1H2,2H3;2-6H,1H2 |
| InChIKey | UVRSIZYNGVVJOO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethenyl-5-methylpyridine;4-ethenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-5-methylpyridine;4-ethenylpyridine?
The IUPAC name of 2-ethenyl-5-methylpyridine;4-ethenylpyridine (CID 166651862) is 2-ethenyl-5-methylpyridine;4-ethenylpyridine.
What is the SMILES notation for 2-ethenyl-5-methylpyridine;4-ethenylpyridine?
The canonical SMILES for 2-ethenyl-5-methylpyridine;4-ethenylpyridine is C=Cc1ccc(C)cn1.C=Cc1ccncc1.
What is the InChIKey of 2-ethenyl-5-methylpyridine;4-ethenylpyridine?
The InChIKey is UVRSIZYNGVVJOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N.C7H7N/c1-3-8-5-4-7(2)6-9-8;1-2-7-3-5-8-6-4-7/h3-6H,1H2,2H3;2-6H,1H2.
What are the key properties of 2-ethenyl-5-methylpyridine;4-ethenylpyridine?
2-ethenyl-5-methylpyridine;4-ethenylpyridine has a molecular weight of 224.31 g/mol, XLogP of 3.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-5-methylpyridine;4-ethenylpyridine is sourced from PubChem (CID 166651862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).