C26H34FN3O3 — CID 16665194
ethyl 2-[4-[4-(2-ethylbutanoylamino)-2-fluorophenyl]piperazin-1-yl]-2-phenylacetate (PubChem CID 16665194) has the molecular formula C26H34FN3O3 and a molecular weight of 455.57 g/mol. Its IUPAC name is ethyl 2-[4-[4-(2-ethylbutanoylamino)-2-fluorophenyl]piperazin-1-yl]-2-phenylacetate.
| Compound Name | ethyl 2-[4-[4-(2-ethylbutanoylamino)-2-fluorophenyl]piperazin-1-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 16665194 |
| Molecular Formula | C26H34FN3O3 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | ethyl 2-[4-[4-(2-ethylbutanoylamino)-2-fluorophenyl]piperazin-1-yl]-2-phenylacetate |
| SMILES | CCOC(=O)C(c1ccccc1)N1CCN(c2ccc(NC(=O)C(CC)CC)cc2F)CC1 |
| InChI | InChI=1S/C26H34FN3O3/c1-4-19(5-2)25(31)28-21-12-13-23(22(27)18-21)29-14-16-30(17-15-29)24(26(32)33-6-3)20-10-8-7-9-11-20/h7-13,18-19,24H,4-6,14-17H2,1-3H3,(H,28,31) |
| InChIKey | YGFNAGQYVASDSI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|