C6H8N2O2 — CID 166651961
3-methyl-1,7-dihydro-1,3-diazepine-2,4-dione (PubChem CID 166651961) has the molecular formula C6H8N2O2 and a molecular weight of 140.14 g/mol. Its IUPAC name is 3-methyl-1,7-dihydro-1,3-diazepine-2,4-dione.
| Compound Name | 3-methyl-1,7-dihydro-1,3-diazepine-2,4-dione |
|---|---|
| PubChem CID | 166651961 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 3-methyl-1,7-dihydro-1,3-diazepine-2,4-dione |
| SMILES | CN1C(=O)C=CCNC1=O |
| InChI | InChI=1S/C6H8N2O2/c1-8-5(9)3-2-4-7-6(8)10/h2-3H,4H2,1H3,(H,7,10) |
| InChIKey | HFQZRBUFEDPDHH-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |