C24H23F3N3O2P — CID 166652186
3-(ethyldiazenyl)-2-methyl-5-[2,3,6-trifluoro-4-[3-(methylaminomethyl)phenyl]-5-phosphanylphenyl]benzoic acid (PubChem CID 166652186) has the molecular formula C24H23F3N3O2P and a molecular weight of 473.44 g/mol. Its IUPAC name is 3-(ethyldiazenyl)-2-methyl-5-[2,3,6-trifluoro-4-[3-(methylaminomethyl)phenyl]-5-phosphanylphenyl]benzoic acid.
| Compound Name | 3-(ethyldiazenyl)-2-methyl-5-[2,3,6-trifluoro-4-[3-(methylaminomethyl)phenyl]-5-phosphanylphenyl]benzoic acid |
|---|---|
| PubChem CID | 166652186 |
| Molecular Formula | C24H23F3N3O2P |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 3-(ethyldiazenyl)-2-methyl-5-[2,3,6-trifluoro-4-[3-(methylaminomethyl)phenyl]-5-phosphanylphenyl]benzoic acid |
| SMILES | CC/N=N/c1cc(-c2c(F)c(F)c(-c3cccc(CNC)c3)c(P)c2F)cc(C(=O)O)c1C |
| InChI | InChI=1S/C24H23F3N3O2P/c1-4-29-30-17-10-15(9-16(12(17)2)24(31)32)18-20(25)21(26)19(23(33)22(18)27)14-7-5-6-13(8-14)11-28-3/h5-10,28H,4,11,33H2,1-3H3,(H,31,32)/b30-29+ |
| InChIKey | CATFDSYZZSEGDC-QVIHXGFCSA-N |
| XLogP | 5.77 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|