C20H21Cl2N7O — CID 166652863
N-[6-(4-amino-4-cyclopropylpiperidin-1-yl)-3-(2,3-dichlorophenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-yl]formamide (PubChem CID 166652863) has the molecular formula C20H21Cl2N7O and a molecular weight of 446.34 g/mol. Its IUPAC name is N-[6-(4-amino-4-cyclopropylpiperidin-1-yl)-3-(2,3-dichlorophenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-yl]formamide.
| Compound Name | N-[6-(4-amino-4-cyclopropylpiperidin-1-yl)-3-(2,3-dichlorophenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-yl]formamide |
|---|---|
| PubChem CID | 166652863 |
| Molecular Formula | C20H21Cl2N7O |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-[6-(4-amino-4-cyclopropylpiperidin-1-yl)-3-(2,3-dichlorophenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-yl]formamide |
| SMILES | NC1(C2CC2)CCN(c2nc(NC=O)c3c(-c4cccc(Cl)c4Cl)[nH]nc3n2)CC1 |
| InChI | InChI=1S/C20H21Cl2N7O/c21-13-3-1-2-12(15(13)22)16-14-17(24-10-30)25-19(26-18(14)28-27-16)29-8-6-20(23,7-9-29)11-4-5-11/h1-3,10-11H,4-9,23H2,(H2,24,25,26,27,28,30) |
| InChIKey | DJAGMYVWGCLPPH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|