About 2-[4-amino-3-(chloro-dimethyl-oxo-λ6-sulfanyl)phenyl]acetic acid
2-[4-amino-3-(chloro-dimethyl-oxo-λ6-sulfanyl)phenyl]acetic acid (PubChem CID 166653003) has the molecular formula C10H14ClNO3S
and a molecular weight of 263.75 g/mol. Its IUPAC name is 2-[4-amino-3-(chloro-dimethyl-oxo-λ6-sulfanyl)phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-amino-3-(chloro-dimethyl-oxo-λ6-sulfanyl)phenyl]acetic acid |
| PubChem CID | 166653003 |
| Molecular Formula | C10H14ClNO3S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-[4-amino-3-(chloro-dimethyl-oxo-λ6-sulfanyl)phenyl]acetic acid |
| SMILES | CS(C)(=O)(Cl)c1cc(CC(=O)O)ccc1N |
| InChI | InChI=1S/C10H14ClNO3S/c1-16(2,11,15)9-5-7(6-10(13)14)3-4-8(9)12/h3-5H,6,12H2,1-2H3,(H,13,14) |
| InChIKey | FKBFVRAZRFJCEI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-amino-3-(chloro-dimethyl-oxo-λ6-sulfanyl)phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-amino-3-(chloro-dimethyl-oxo-λ6-sulfanyl)phenyl]acetic acid?
The IUPAC name of 2-[4-amino-3-(chloro-dimethyl-oxo-λ6-sulfanyl)phenyl]acetic acid (CID 166653003) is 2-[4-amino-3-(chloro-dimethyl-oxo-λ6-sulfanyl)phenyl]acetic acid.
What is the SMILES notation for 2-[4-amino-3-(chloro-dimethyl-oxo-λ6-sulfanyl)phenyl]acetic acid?
The canonical SMILES for 2-[4-amino-3-(chloro-dimethyl-oxo-λ6-sulfanyl)phenyl]acetic acid is CS(C)(=O)(Cl)c1cc(CC(=O)O)ccc1N.
What is the InChIKey of 2-[4-amino-3-(chloro-dimethyl-oxo-λ6-sulfanyl)phenyl]acetic acid?
The InChIKey is FKBFVRAZRFJCEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClNO3S/c1-16(2,11,15)9-5-7(6-10(13)14)3-4-8(9)12/h3-5H,6,12H2,1-2H3,(H,13,14).
What are the key properties of 2-[4-amino-3-(chloro-dimethyl-oxo-λ6-sulfanyl)phenyl]acetic acid?
2-[4-amino-3-(chloro-dimethyl-oxo-λ6-sulfanyl)phenyl]acetic acid has a molecular weight of 263.75 g/mol, XLogP of 1.49, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-amino-3-(chloro-dimethyl-oxo-λ6-sulfanyl)phenyl]acetic acid is sourced from PubChem (CID 166653003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).