About 4-(2-azido-1-methoxypropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one
4-(2-azido-1-methoxypropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one (PubChem CID 166653554) has the molecular formula C12H12ClN5O2
and a molecular weight of 293.71 g/mol. Its IUPAC name is 4-(2-azido-1-methoxypropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one.
Molecular Properties
| Compound Name | 4-(2-azido-1-methoxypropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one |
| PubChem CID | 166653554 |
| Molecular Formula | C12H12ClN5O2 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 4-(2-azido-1-methoxypropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one |
| SMILES | COCC(C)(N=[N+]=[N-])c1c[nH]c(=O)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C12H12ClN5O2/c1-12(6-20-2,17-18-14)9-5-16-11(19)8-4-15-10(13)3-7(8)9/h3-5H,6H2,1-2H3,(H,16,19) |
| InChIKey | OCVUANHTOJHKIO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 103.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-azido-1-methoxypropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-azido-1-methoxypropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one?
The IUPAC name of 4-(2-azido-1-methoxypropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one (CID 166653554) is 4-(2-azido-1-methoxypropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one.
What is the SMILES notation for 4-(2-azido-1-methoxypropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one?
The canonical SMILES for 4-(2-azido-1-methoxypropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one is COCC(C)(N=[N+]=[N-])c1c[nH]c(=O)c2cnc(Cl)cc12.
What is the InChIKey of 4-(2-azido-1-methoxypropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one?
The InChIKey is OCVUANHTOJHKIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClN5O2/c1-12(6-20-2,17-18-14)9-5-16-11(19)8-4-15-10(13)3-7(8)9/h3-5H,6H2,1-2H3,(H,16,19).
What are the key properties of 4-(2-azido-1-methoxypropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one?
4-(2-azido-1-methoxypropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one has a molecular weight of 293.71 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-azido-1-methoxypropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one is sourced from PubChem (CID 166653554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).