About 1-[(1R)-cyclohepta-2,3-dien-1-yl]-2-methylazetidine
1-[(1R)-cyclohepta-2,3-dien-1-yl]-2-methylazetidine (PubChem CID 166653897) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 1-[(1R)-cyclohepta-2,3-dien-1-yl]-2-methylazetidine.
Molecular Properties
| Compound Name | 1-[(1R)-cyclohepta-2,3-dien-1-yl]-2-methylazetidine |
| PubChem CID | 166653897 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 1-[(1R)-cyclohepta-2,3-dien-1-yl]-2-methylazetidine |
| SMILES | CC1CCN1[C@H]1C=C=CCCC1 |
| InChI | InChI=1S/C11H17N/c1-10-8-9-12(10)11-6-4-2-3-5-7-11/h2,6,10-11H,3,5,7-9H2,1H3/t10?,11-/m0/s1 |
| InChIKey | HOQTXCARIJHBIA-DTIOYNMSSA-N |
| XLogP | 2.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(1R)-cyclohepta-2,3-dien-1-yl]-2-methylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R)-cyclohepta-2,3-dien-1-yl]-2-methylazetidine?
The IUPAC name of 1-[(1R)-cyclohepta-2,3-dien-1-yl]-2-methylazetidine (CID 166653897) is 1-[(1R)-cyclohepta-2,3-dien-1-yl]-2-methylazetidine.
What is the SMILES notation for 1-[(1R)-cyclohepta-2,3-dien-1-yl]-2-methylazetidine?
The canonical SMILES for 1-[(1R)-cyclohepta-2,3-dien-1-yl]-2-methylazetidine is CC1CCN1[C@H]1C=C=CCCC1.
What is the InChIKey of 1-[(1R)-cyclohepta-2,3-dien-1-yl]-2-methylazetidine?
The InChIKey is HOQTXCARIJHBIA-DTIOYNMSSA-N. The full InChI is InChI=1S/C11H17N/c1-10-8-9-12(10)11-6-4-2-3-5-7-11/h2,6,10-11H,3,5,7-9H2,1H3/t10?,11-/m0/s1.
What are the key properties of 1-[(1R)-cyclohepta-2,3-dien-1-yl]-2-methylazetidine?
1-[(1R)-cyclohepta-2,3-dien-1-yl]-2-methylazetidine has a molecular weight of 163.26 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R)-cyclohepta-2,3-dien-1-yl]-2-methylazetidine is sourced from PubChem (CID 166653897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).