C14H6F8S2 — CID 166653974
4-(4-ethylsulfanyl-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorobenzenethiol (PubChem CID 166653974) has the molecular formula C14H6F8S2 and a molecular weight of 390.32 g/mol. Its IUPAC name is 4-(4-ethylsulfanyl-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorobenzenethiol.
| Compound Name | 4-(4-ethylsulfanyl-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorobenzenethiol |
|---|---|
| PubChem CID | 166653974 |
| Molecular Formula | C14H6F8S2 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | 4-(4-ethylsulfanyl-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorobenzenethiol |
| SMILES | CCSc1c(F)c(F)c(-c2c(F)c(F)c(S)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C14H6F8S2/c1-2-24-14-11(21)7(17)4(8(18)12(14)22)3-5(15)9(19)13(23)10(20)6(3)16/h23H,2H2,1H3 |
| InChIKey | MLFRYPBUXDZDQX-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|