About 1-butan-2-yl-2,5-dimethylidene-3-methylsulfanylpyrrolidine
1-butan-2-yl-2,5-dimethylidene-3-methylsulfanylpyrrolidine (PubChem CID 166654541) has the molecular formula C11H19NS
and a molecular weight of 197.35 g/mol. Its IUPAC name is 1-butan-2-yl-2,5-dimethylidene-3-methylsulfanylpyrrolidine.
Molecular Properties
| Compound Name | 1-butan-2-yl-2,5-dimethylidene-3-methylsulfanylpyrrolidine |
| PubChem CID | 166654541 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-butan-2-yl-2,5-dimethylidene-3-methylsulfanylpyrrolidine |
| SMILES | C=C1CC(SC)C(=C)N1C(C)CC |
| InChI | InChI=1S/C11H19NS/c1-6-8(2)12-9(3)7-11(13-5)10(12)4/h8,11H,3-4,6-7H2,1-2,5H3 |
| InChIKey | AMDFGUUHYXVRNT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butan-2-yl-2,5-dimethylidene-3-methylsulfanylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-2,5-dimethylidene-3-methylsulfanylpyrrolidine?
The IUPAC name of 1-butan-2-yl-2,5-dimethylidene-3-methylsulfanylpyrrolidine (CID 166654541) is 1-butan-2-yl-2,5-dimethylidene-3-methylsulfanylpyrrolidine.
What is the SMILES notation for 1-butan-2-yl-2,5-dimethylidene-3-methylsulfanylpyrrolidine?
The canonical SMILES for 1-butan-2-yl-2,5-dimethylidene-3-methylsulfanylpyrrolidine is C=C1CC(SC)C(=C)N1C(C)CC.
What is the InChIKey of 1-butan-2-yl-2,5-dimethylidene-3-methylsulfanylpyrrolidine?
The InChIKey is AMDFGUUHYXVRNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NS/c1-6-8(2)12-9(3)7-11(13-5)10(12)4/h8,11H,3-4,6-7H2,1-2,5H3.
What are the key properties of 1-butan-2-yl-2,5-dimethylidene-3-methylsulfanylpyrrolidine?
1-butan-2-yl-2,5-dimethylidene-3-methylsulfanylpyrrolidine has a molecular weight of 197.35 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-2,5-dimethylidene-3-methylsulfanylpyrrolidine is sourced from PubChem (CID 166654541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).