C15H21F3O2 — CID 166655114
6-methyl-5-[(2E)-3-(2,2,2-trifluoroethoxymethyl)hexa-2,5-dienyl]-3,4-dihydro-2H-pyran (PubChem CID 166655114) has the molecular formula C15H21F3O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 6-methyl-5-[(2E)-3-(2,2,2-trifluoroethoxymethyl)hexa-2,5-dienyl]-3,4-dihydro-2H-pyran.
| Compound Name | 6-methyl-5-[(2E)-3-(2,2,2-trifluoroethoxymethyl)hexa-2,5-dienyl]-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 166655114 |
| Molecular Formula | C15H21F3O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 6-methyl-5-[(2E)-3-(2,2,2-trifluoroethoxymethyl)hexa-2,5-dienyl]-3,4-dihydro-2H-pyran |
| SMILES | C=CC/C(=C\CC1=C(C)OCCC1)COCC(F)(F)F |
| InChI | InChI=1S/C15H21F3O2/c1-3-5-13(10-19-11-15(16,17)18)7-8-14-6-4-9-20-12(14)2/h3,7H,1,4-6,8-11H2,2H3/b13-7+ |
| InChIKey | BGRFEWIQYOYWMV-NTUHNPAUSA-N |
| XLogP | 4.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|