C23H29FN2O3S — CID 166655477
(E,2E)-4-[4-fluoro-3-[(3-imino-2-methylpentan-2-yl)sulfonylmethyl]phenoxy]-2-prop-2-enylidenehept-3-enenitrile (PubChem CID 166655477) has the molecular formula C23H29FN2O3S and a molecular weight of 432.56 g/mol. Its IUPAC name is (E,2E)-4-[4-fluoro-3-[(3-imino-2-methylpentan-2-yl)sulfonylmethyl]phenoxy]-2-prop-2-enylidenehept-3-enenitrile.
| Compound Name | (E,2E)-4-[4-fluoro-3-[(3-imino-2-methylpentan-2-yl)sulfonylmethyl]phenoxy]-2-prop-2-enylidenehept-3-enenitrile |
|---|---|
| PubChem CID | 166655477 |
| Molecular Formula | C23H29FN2O3S |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (E,2E)-4-[4-fluoro-3-[(3-imino-2-methylpentan-2-yl)sulfonylmethyl]phenoxy]-2-prop-2-enylidenehept-3-enenitrile |
| SMILES | [H]/N=C(\CC)C(C)(C)S(=O)(=O)Cc1cc(O/C(=C/C(C#N)=C\C=C)CCC)ccc1F |
| InChI | InChI=1S/C23H29FN2O3S/c1-6-9-17(15-25)13-19(10-7-2)29-20-11-12-21(24)18(14-20)16-30(27,28)23(4,5)22(26)8-3/h6,9,11-14,26H,1,7-8,10,16H2,2-5H3/b17-9+,19-13+,26-22+ |
| InChIKey | DPFROBOANGRFBN-AGZCKAIFSA-N |
| XLogP | 5.65 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|