C20H31FO2 — CID 166655504
(1S,2R,3S,4S,7R,8S,10S,14R)-4-ethenyl-10-fluoro-3-hydroxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-9-one (PubChem CID 166655504) has the molecular formula C20H31FO2 and a molecular weight of 322.46 g/mol. Its IUPAC name is (1S,2R,3S,4S,7R,8S,10S,14R)-4-ethenyl-10-fluoro-3-hydroxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-9-one.
| Compound Name | (1S,2R,3S,4S,7R,8S,10S,14R)-4-ethenyl-10-fluoro-3-hydroxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-9-one |
|---|---|
| PubChem CID | 166655504 |
| Molecular Formula | C20H31FO2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (1S,2R,3S,4S,7R,8S,10S,14R)-4-ethenyl-10-fluoro-3-hydroxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-9-one |
| SMILES | C=C[C@]1(C)CC[C@]2(C)[C@H](C)CC[C@]3(C[C@H](F)C(=O)[C@@H]23)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C20H31FO2/c1-6-18(4)9-10-19(5)12(2)7-8-20(13(3)17(18)23)11-14(21)15(22)16(19)20/h6,12-14,16-17,23H,1,7-11H2,2-5H3/t12-,13+,14+,16+,17+,18-,19-,20+/m1/s1 |
| InChIKey | FTIRJGVYZOZFOG-DYVKGSRDSA-N |
| XLogP | 4.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|