C20H29FO2 — CID 166655631
(1R,2R,3S,4S,7R,8R,10S,11S)-4-ethenyl-11-fluoro-3-hydroxy-2,4,7,8-tetramethyltetracyclo[9.2.1.01,10.07,13]tetradecan-12-one (PubChem CID 166655631) has the molecular formula C20H29FO2 and a molecular weight of 320.45 g/mol. Its IUPAC name is (1R,2R,3S,4S,7R,8R,10S,11S)-4-ethenyl-11-fluoro-3-hydroxy-2,4,7,8-tetramethyltetracyclo[9.2.1.01,10.07,13]tetradecan-12-one.
| Compound Name | (1R,2R,3S,4S,7R,8R,10S,11S)-4-ethenyl-11-fluoro-3-hydroxy-2,4,7,8-tetramethyltetracyclo[9.2.1.01,10.07,13]tetradecan-12-one |
|---|---|
| PubChem CID | 166655631 |
| Molecular Formula | C20H29FO2 |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (1R,2R,3S,4S,7R,8R,10S,11S)-4-ethenyl-11-fluoro-3-hydroxy-2,4,7,8-tetramethyltetracyclo[9.2.1.01,10.07,13]tetradecan-12-one |
| SMILES | C=C[C@]1(C)CC[C@@]2(C)C3C(=O)[C@]4(F)C[C@]3([C@@H](C)[C@@H]1O)[C@@H]4C[C@H]2C |
| InChI | InChI=1S/C20H29FO2/c1-6-17(4)7-8-18(5)11(2)9-13-19(12(3)15(17)22)10-20(13,21)16(23)14(18)19/h6,11-15,22H,1,7-10H2,2-5H3/t11-,12+,13+,14?,15+,17-,18-,19+,20+/m1/s1 |
| InChIKey | YVRPSVPJJBYCQB-HUNAWYBMSA-N |
| XLogP | 3.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|