C23H37FN2 — CID 166655955
(3E,5E)-6-(2,5-diethyl-5-fluoro-4-methyl-2-azabicyclo[5.2.1]dec-8-en-1-yl)-N-methylocta-1,3,5-trien-4-amine (PubChem CID 166655955) has the molecular formula C23H37FN2 and a molecular weight of 360.56 g/mol. Its IUPAC name is (3E,5E)-6-(2,5-diethyl-5-fluoro-4-methyl-2-azabicyclo[5.2.1]dec-8-en-1-yl)-N-methylocta-1,3,5-trien-4-amine.
| Compound Name | (3E,5E)-6-(2,5-diethyl-5-fluoro-4-methyl-2-azabicyclo[5.2.1]dec-8-en-1-yl)-N-methylocta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 166655955 |
| Molecular Formula | C23H37FN2 |
| Molecular Weight | 360.56 g/mol |
| Exact Mass | 360.29 |
| IUPAC Name | (3E,5E)-6-(2,5-diethyl-5-fluoro-4-methyl-2-azabicyclo[5.2.1]dec-8-en-1-yl)-N-methylocta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(\C=C(/CC)C12C=CC(CC(F)(CC)C(C)CN1CC)C2)NC |
| InChI | InChI=1S/C23H37FN2/c1-7-11-21(25-6)14-20(8-2)23-13-12-19(16-23)15-22(24,9-3)18(5)17-26(23)10-4/h7,11-14,18-19,25H,1,8-10,15-17H2,2-6H3/b20-14+,21-11+ |
| InChIKey | RZZKSZWQBNQJMH-OGXJSFTLSA-N |
| XLogP | 5.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|